C16H23NS — CID 103784505
N-(3-methylsulfanylcyclohexyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 103784505) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is N-(3-methylsulfanylcyclohexyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(3-methylsulfanylcyclohexyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 103784505 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-(3-methylsulfanylcyclohexyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | CSC1CCCC(NC2CCc3ccccc32)C1 |
| InChI | InChI=1S/C16H23NS/c1-18-14-7-4-6-13(11-14)17-16-10-9-12-5-2-3-8-15(12)16/h2-3,5,8,13-14,16-17H,4,6-7,9-11H2,1H3 |
| InChIKey | QXXXXQVFDRXGRB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |