C14H9F5 — CID 10378519
1-(2,3-dimethylphenyl)-2,3,4,5,6-pentafluorobenzene (PubChem CID 10378519) has the molecular formula C14H9F5 and a molecular weight of 272.22 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(2,3-dimethylphenyl)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 10378519 |
| Molecular Formula | C14H9F5 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-2,3,4,5,6-pentafluorobenzene |
| SMILES | Cc1cccc(-c2c(F)c(F)c(F)c(F)c2F)c1C |
| InChI | InChI=1S/C14H9F5/c1-6-4-3-5-8(7(6)2)9-10(15)12(17)14(19)13(18)11(9)16/h3-5H,1-2H3 |
| InChIKey | OPEMOUJWGRLHSS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|