About 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol
3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol (PubChem CID 103785817) has the molecular formula C14H25F3N2O
and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol |
| PubChem CID | 103785817 |
| Molecular Formula | C14H25F3N2O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCCC(CNC2CCN(CC(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C14H25F3N2O/c15-14(16,17)10-19-6-4-12(5-7-19)18-9-11-2-1-3-13(20)8-11/h11-13,18,20H,1-10H2 |
| InChIKey | IYFDBRODGIMCDA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol?
The IUPAC name of 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol (CID 103785817) is 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol.
What is the SMILES notation for 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol?
The canonical SMILES for 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol is OC1CCCC(CNC2CCN(CC(F)(F)F)CC2)C1.
What is the InChIKey of 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol?
The InChIKey is IYFDBRODGIMCDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F3N2O/c15-14(16,17)10-19-6-4-12(5-7-19)18-9-11-2-1-3-13(20)8-11/h11-13,18,20H,1-10H2.
What are the key properties of 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol?
3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol has a molecular weight of 294.36 g/mol, XLogP of 2.15, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]methyl]cyclohexan-1-ol is sourced from PubChem (CID 103785817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).