C13H17NS2 — CID 103786897
(6S)-6-methyl-N-pent-4-ynyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine (PubChem CID 103786897) has the molecular formula C13H17NS2 and a molecular weight of 251.42 g/mol. Its IUPAC name is (6S)-6-methyl-N-pent-4-ynyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine.
| Compound Name | (6S)-6-methyl-N-pent-4-ynyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
|---|---|
| PubChem CID | 103786897 |
| Molecular Formula | C13H17NS2 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (6S)-6-methyl-N-pent-4-ynyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
| SMILES | C#CCCCNC1C[C@H](C)Sc2sccc21 |
| InChI | InChI=1S/C13H17NS2/c1-3-4-5-7-14-12-9-10(2)16-13-11(12)6-8-15-13/h1,6,8,10,12,14H,4-5,7,9H2,2H3/t10-,12?/m0/s1 |
| InChIKey | HVRQNMMGIHMGDP-NUHJPDEHSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|