About N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine
N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine (PubChem CID 103786961) has the molecular formula C14H16N2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine.
Molecular Properties
| Compound Name | N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine |
| PubChem CID | 103786961 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine |
| SMILES | C#CCCCNC(C)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C14H16N2S/c1-3-4-5-7-15-11(2)12-9-14-13(16-10-12)6-8-17-14/h1,6,8-11,15H,4-5,7H2,2H3 |
| InChIKey | UFVBZHVBKDJPNH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine?
The IUPAC name of N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine (CID 103786961) is N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine.
What is the SMILES notation for N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine?
The canonical SMILES for N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine is C#CCCCNC(C)c1cnc2ccsc2c1.
What is the InChIKey of N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine?
The InChIKey is UFVBZHVBKDJPNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2S/c1-3-4-5-7-15-11(2)12-9-14-13(16-10-12)6-8-17-14/h1,6,8-11,15H,4-5,7H2,2H3.
What are the key properties of N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine?
N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine has a molecular weight of 244.36 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-thieno[3,2-b]pyridin-6-ylethyl)pent-4-yn-1-amine is sourced from PubChem (CID 103786961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).