About 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine
6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 103787071) has the molecular formula C15H17ClN2S2
and a molecular weight of 324.90 g/mol. Its IUPAC name is 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine |
| PubChem CID | 103787071 |
| Molecular Formula | C15H17ClN2S2 |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCc1cnc(CNC2CCSc3ccc(Cl)cc32)s1 |
| InChI | InChI=1S/C15H17ClN2S2/c1-2-11-8-18-15(20-11)9-17-13-5-6-19-14-4-3-10(16)7-12(13)14/h3-4,7-8,13,17H,2,5-6,9H2,1H3 |
| InChIKey | HRMXFMIQYHZXAH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine?
The IUPAC name of 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine (CID 103787071) is 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine.
What is the SMILES notation for 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine?
The canonical SMILES for 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine is CCc1cnc(CNC2CCSc3ccc(Cl)cc32)s1.
What is the InChIKey of 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine?
The InChIKey is HRMXFMIQYHZXAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClN2S2/c1-2-11-8-18-15(20-11)9-17-13-5-6-19-14-4-3-10(16)7-12(13)14/h3-4,7-8,13,17H,2,5-6,9H2,1H3.
What are the key properties of 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine?
6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine has a molecular weight of 324.90 g/mol, XLogP of 4.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-thiochromen-4-amine is sourced from PubChem (CID 103787071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).