C16H20O2S — CID 10378750
(2R,3S,5S)-5-tert-butyl-2-(4-ethynylphenyl)-1,3-oxathiane 3-oxide (PubChem CID 10378750) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is (2R,3S,5S)-5-tert-butyl-2-(4-ethynylphenyl)-1,3-oxathiane 3-oxide.
| Compound Name | (2R,3S,5S)-5-tert-butyl-2-(4-ethynylphenyl)-1,3-oxathiane 3-oxide |
|---|---|
| PubChem CID | 10378750 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2R,3S,5S)-5-tert-butyl-2-(4-ethynylphenyl)-1,3-oxathiane 3-oxide |
| SMILES | C#Cc1ccc([C@@H]2OC[C@H](C(C)(C)C)C[S@@]2=O)cc1 |
| InChI | InChI=1S/C16H20O2S/c1-5-12-6-8-13(9-7-12)15-18-10-14(11-19(15)17)16(2,3)4/h1,6-9,14-15H,10-11H2,2-4H3/t14-,15+,19-/m0/s1 |
| InChIKey | CGGFEGVHEPVHME-KHYOSLBOSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|