About 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol
1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol (PubChem CID 103787929) has the molecular formula C8H12F2N2OS
and a molecular weight of 222.26 g/mol. Its IUPAC name is 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol.
Molecular Properties
| Compound Name | 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol |
| PubChem CID | 103787929 |
| Molecular Formula | C8H12F2N2OS |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol |
| SMILES | CC(NCC(O)C(F)F)c1cncs1 |
| InChI | InChI=1S/C8H12F2N2OS/c1-5(7-3-11-4-14-7)12-2-6(13)8(9)10/h3-6,8,12-13H,2H2,1H3 |
| InChIKey | FSRHPIRQKYYFAB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol?
The IUPAC name of 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol (CID 103787929) is 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol.
What is the SMILES notation for 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol?
The canonical SMILES for 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol is CC(NCC(O)C(F)F)c1cncs1.
What is the InChIKey of 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol?
The InChIKey is FSRHPIRQKYYFAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2OS/c1-5(7-3-11-4-14-7)12-2-6(13)8(9)10/h3-6,8,12-13H,2H2,1H3.
What are the key properties of 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol?
1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol has a molecular weight of 222.26 g/mol, XLogP of 1.42, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-3-[1-(1,3-thiazol-5-yl)ethylamino]propan-2-ol is sourced from PubChem (CID 103787929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).