About 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol
3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol (PubChem CID 103787951) has the molecular formula C9H11Cl2F2NOS
and a molecular weight of 290.16 g/mol. Its IUPAC name is 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol |
| PubChem CID | 103787951 |
| Molecular Formula | C9H11Cl2F2NOS |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol |
| SMILES | CC(NCC(O)C(F)F)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H11Cl2F2NOS/c1-4(14-3-6(15)9(12)13)5-2-7(10)16-8(5)11/h2,4,6,9,14-15H,3H2,1H3 |
| InChIKey | HDNWQVVZUDQUKS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol?
The IUPAC name of 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol (CID 103787951) is 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol.
What is the SMILES notation for 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol?
The canonical SMILES for 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol is CC(NCC(O)C(F)F)c1cc(Cl)sc1Cl.
What is the InChIKey of 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol?
The InChIKey is HDNWQVVZUDQUKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2F2NOS/c1-4(14-3-6(15)9(12)13)5-2-7(10)16-8(5)11/h2,4,6,9,14-15H,3H2,1H3.
What are the key properties of 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol?
3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol has a molecular weight of 290.16 g/mol, XLogP of 3.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,5-dichlorothiophen-3-yl)ethylamino]-1,1-difluoropropan-2-ol is sourced from PubChem (CID 103787951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).