C13H24F2N2O — CID 103787959
1,1-difluoro-3-[[1-(3-methylbut-2-enyl)piperidin-4-yl]amino]propan-2-ol (PubChem CID 103787959) has the molecular formula C13H24F2N2O and a molecular weight of 262.34 g/mol. Its IUPAC name is 1,1-difluoro-3-[[1-(3-methylbut-2-enyl)piperidin-4-yl]amino]propan-2-ol.
| Compound Name | 1,1-difluoro-3-[[1-(3-methylbut-2-enyl)piperidin-4-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 103787959 |
| Molecular Formula | C13H24F2N2O |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1,1-difluoro-3-[[1-(3-methylbut-2-enyl)piperidin-4-yl]amino]propan-2-ol |
| SMILES | CC(C)=CCN1CCC(NCC(O)C(F)F)CC1 |
| InChI | InChI=1S/C13H24F2N2O/c1-10(2)3-6-17-7-4-11(5-8-17)16-9-12(18)13(14)15/h3,11-13,16,18H,4-9H2,1-2H3 |
| InChIKey | HBUXFQWBEJXOBG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|