C13H19F2N3O — CID 103787981
1,1-difluoro-3-[(1-pyridin-2-ylpiperidin-4-yl)amino]propan-2-ol (PubChem CID 103787981) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is 1,1-difluoro-3-[(1-pyridin-2-ylpiperidin-4-yl)amino]propan-2-ol.
| Compound Name | 1,1-difluoro-3-[(1-pyridin-2-ylpiperidin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 103787981 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1,1-difluoro-3-[(1-pyridin-2-ylpiperidin-4-yl)amino]propan-2-ol |
| SMILES | OC(CNC1CCN(c2ccccn2)CC1)C(F)F |
| InChI | InChI=1S/C13H19F2N3O/c14-13(15)11(19)9-17-10-4-7-18(8-5-10)12-3-1-2-6-16-12/h1-3,6,10-11,13,17,19H,4-5,7-9H2 |
| InChIKey | GDVLFPOSNHVRTP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |