C14H16BrN — CID 10378814
3-(2-bromoethyl)-2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (PubChem CID 10378814) has the molecular formula C14H16BrN and a molecular weight of 278.19 g/mol. Its IUPAC name is 3-(2-bromoethyl)-2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene.
| Compound Name | 3-(2-bromoethyl)-2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 10378814 |
| Molecular Formula | C14H16BrN |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-(2-bromoethyl)-2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| SMILES | Cc1c(CCBr)c2cccc3c2n1CCC3 |
| InChI | InChI=1S/C14H16BrN/c1-10-12(7-8-15)13-6-2-4-11-5-3-9-16(10)14(11)13/h2,4,6H,3,5,7-9H2,1H3 |
| InChIKey | KZRJXMHLTUGNEQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|