C15H28N2O2S — CID 103788176
tert-butyl 3-[(2-methylsulfanylcyclohexyl)amino]azetidine-1-carboxylate (PubChem CID 103788176) has the molecular formula C15H28N2O2S and a molecular weight of 300.47 g/mol. Its IUPAC name is tert-butyl 3-[(2-methylsulfanylcyclohexyl)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-methylsulfanylcyclohexyl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 103788176 |
| Molecular Formula | C15H28N2O2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | tert-butyl 3-[(2-methylsulfanylcyclohexyl)amino]azetidine-1-carboxylate |
| SMILES | CSC1CCCCC1NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28N2O2S/c1-15(2,3)19-14(18)17-9-11(10-17)16-12-7-5-6-8-13(12)20-4/h11-13,16H,5-10H2,1-4H3 |
| InChIKey | YPXKKEGGNXKPSG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |