C11H19ClN2O4 — CID 10378852
tert-butyl (4S)-4-[(E)-C-chloro-N-hydroxycarbonimidoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10378852) has the molecular formula C11H19ClN2O4 and a molecular weight of 278.74 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(E)-C-chloro-N-hydroxycarbonimidoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(E)-C-chloro-N-hydroxycarbonimidoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10378852 |
| Molecular Formula | C11H19ClN2O4 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | tert-butyl (4S)-4-[(E)-C-chloro-N-hydroxycarbonimidoyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C(Cl)=N\O)COC1(C)C |
| InChI | InChI=1S/C11H19ClN2O4/c1-10(2,3)18-9(15)14-7(8(12)13-16)6-17-11(14,4)5/h7,16H,6H2,1-5H3/b13-8+/t7-/m0/s1 |
| InChIKey | OTUIGFABXJJKOL-AXGKHFFLSA-N |
| XLogP | 2.38 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|