C10H15BrO4 — CID 10378856
1-bromo-3,3,6,6-tetramethoxycyclohexa-1,4-diene (PubChem CID 10378856) has the molecular formula C10H15BrO4 and a molecular weight of 279.13 g/mol. Its IUPAC name is 1-bromo-3,3,6,6-tetramethoxycyclohexa-1,4-diene.
| Compound Name | 1-bromo-3,3,6,6-tetramethoxycyclohexa-1,4-diene |
|---|---|
| PubChem CID | 10378856 |
| Molecular Formula | C10H15BrO4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1-bromo-3,3,6,6-tetramethoxycyclohexa-1,4-diene |
| SMILES | COC1(OC)C=CC(OC)(OC)C(Br)=C1 |
| InChI | InChI=1S/C10H15BrO4/c1-12-9(13-2)5-6-10(14-3,15-4)8(11)7-9/h5-7H,1-4H3 |
| InChIKey | NVIMOSRVNZYMJZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|