C15H25NO — CID 103788664
(2R)-2-(heptan-2-ylamino)-2-phenylethanol (PubChem CID 103788664) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2R)-2-(heptan-2-ylamino)-2-phenylethanol.
| Compound Name | (2R)-2-(heptan-2-ylamino)-2-phenylethanol |
|---|---|
| PubChem CID | 103788664 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2R)-2-(heptan-2-ylamino)-2-phenylethanol |
| SMILES | CCCCCC(C)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C15H25NO/c1-3-4-6-9-13(2)16-15(12-17)14-10-7-5-8-11-14/h5,7-8,10-11,13,15-17H,3-4,6,9,12H2,1-2H3/t13?,15-/m0/s1 |
| InChIKey | MBDMYZLCVBHHRZ-WUJWULDRSA-N |
| XLogP | 3.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|