C15H24N2O — CID 103788675
(2R)-2-[(1,2-dimethylpiperidin-4-yl)amino]-2-phenylethanol (PubChem CID 103788675) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (2R)-2-[(1,2-dimethylpiperidin-4-yl)amino]-2-phenylethanol.
| Compound Name | (2R)-2-[(1,2-dimethylpiperidin-4-yl)amino]-2-phenylethanol |
|---|---|
| PubChem CID | 103788675 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (2R)-2-[(1,2-dimethylpiperidin-4-yl)amino]-2-phenylethanol |
| SMILES | CC1CC(N[C@@H](CO)c2ccccc2)CCN1C |
| InChI | InChI=1S/C15H24N2O/c1-12-10-14(8-9-17(12)2)16-15(11-18)13-6-4-3-5-7-13/h3-7,12,14-16,18H,8-11H2,1-2H3/t12?,14?,15-/m0/s1 |
| InChIKey | QJVWMPCMITTWHY-ZALBZXLWSA-N |
| XLogP | 1.79 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |