C13H21NO — CID 103788966
(2S)-2-[1-(2,5-dimethylphenyl)ethylamino]propan-1-ol (PubChem CID 103788966) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2S)-2-[1-(2,5-dimethylphenyl)ethylamino]propan-1-ol.
| Compound Name | (2S)-2-[1-(2,5-dimethylphenyl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 103788966 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2S)-2-[1-(2,5-dimethylphenyl)ethylamino]propan-1-ol |
| SMILES | Cc1ccc(C)c(C(C)N[C@@H](C)CO)c1 |
| InChI | InChI=1S/C13H21NO/c1-9-5-6-10(2)13(7-9)12(4)14-11(3)8-15/h5-7,11-12,14-15H,8H2,1-4H3/t11-,12?/m0/s1 |
| InChIKey | SRGHBHOAAAQLPU-PXYINDEMSA-N |
| XLogP | 2.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |