About N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine
N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine (PubChem CID 10378921) has the molecular formula C16H16N4O
and a molecular weight of 280.33 g/mol. Its IUPAC name is N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine |
| PubChem CID | 10378921 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1ccc(Nc2n[nH]c(COc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H16N4O/c1-12-7-9-13(10-8-12)17-16-18-15(19-20-16)11-21-14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H2,17,18,19,20) |
| InChIKey | SFRMIFDITSJTKH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine?
The IUPAC name of N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine (CID 10378921) is N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine?
The canonical SMILES for N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine is Cc1ccc(Nc2n[nH]c(COc3ccccc3)n2)cc1.
What is the InChIKey of N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine?
The InChIKey is SFRMIFDITSJTKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O/c1-12-7-9-13(10-8-12)17-16-18-15(19-20-16)11-21-14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H2,17,18,19,20).
What are the key properties of N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine?
N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine has a molecular weight of 280.33 g/mol, XLogP of 3.44, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylphenyl)-5-(phenoxymethyl)-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 10378921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).