About N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide
N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide (PubChem CID 10378936) has the molecular formula C14H20N2O2S
and a molecular weight of 280.39 g/mol. Its IUPAC name is N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide |
| PubChem CID | 10378936 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide |
| SMILES | CCC1=CCCN(NS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C14H20N2O2S/c1-3-13-5-4-10-16(11-13)15-19(17,18)14-8-6-12(2)7-9-14/h5-9,15H,3-4,10-11H2,1-2H3 |
| InChIKey | XQJDQTZUYDOMJX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide?
The IUPAC name of N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide (CID 10378936) is N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide.
What is the SMILES notation for N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide?
The canonical SMILES for N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide is CCC1=CCCN(NS(=O)(=O)c2ccc(C)cc2)C1.
What is the InChIKey of N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide?
The InChIKey is XQJDQTZUYDOMJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2S/c1-3-13-5-4-10-16(11-13)15-19(17,18)14-8-6-12(2)7-9-14/h5-9,15H,3-4,10-11H2,1-2H3.
What are the key properties of N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide?
N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide has a molecular weight of 280.39 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylbenzenesulfonamide is sourced from PubChem (CID 10378936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).