C7H7F3N2O2S — CID 103790018
2-methyl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxamide (PubChem CID 103790018) has the molecular formula C7H7F3N2O2S and a molecular weight of 240.21 g/mol. Its IUPAC name is 2-methyl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-methyl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 103790018 |
| Molecular Formula | C7H7F3N2O2S |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-methyl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NOCC(F)(F)F)s1 |
| InChI | InChI=1S/C7H7F3N2O2S/c1-4-11-2-5(15-4)6(13)12-14-3-7(8,9)10/h2H,3H2,1H3,(H,12,13) |
| InChIKey | XOJVRAJAKUSCCR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|