C17H18N2S — CID 10379052
8-methyl-3-(2-phenylethylsulfanylmethyl)imidazo[1,2-a]pyridine (PubChem CID 10379052) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 8-methyl-3-(2-phenylethylsulfanylmethyl)imidazo[1,2-a]pyridine.
| Compound Name | 8-methyl-3-(2-phenylethylsulfanylmethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 10379052 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 8-methyl-3-(2-phenylethylsulfanylmethyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1cccn2c(CSCCc3ccccc3)cnc12 |
| InChI | InChI=1S/C17H18N2S/c1-14-6-5-10-19-16(12-18-17(14)19)13-20-11-9-15-7-3-2-4-8-15/h2-8,10,12H,9,11,13H2,1H3 |
| InChIKey | WKXUDDJQGBPDOQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|