About N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide
N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide (PubChem CID 1037907) has the molecular formula C14H10BrN3O2S
and a molecular weight of 364.22 g/mol. Its IUPAC name is N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide.
Molecular Properties
| Compound Name | N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide |
| PubChem CID | 1037907 |
| Molecular Formula | C14H10BrN3O2S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide |
| SMILES | O=C(NNc1nc(-c2ccc(Br)cc2)cs1)c1ccco1 |
| InChI | InChI=1S/C14H10BrN3O2S/c15-10-5-3-9(4-6-10)11-8-21-14(16-11)18-17-13(19)12-2-1-7-20-12/h1-8H,(H,16,18)(H,17,19) |
| InChIKey | MAPXRAPQHDKUQF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide?
The IUPAC name of N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide (CID 1037907) is N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide.
What is the SMILES notation for N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide?
The canonical SMILES for N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide is O=C(NNc1nc(-c2ccc(Br)cc2)cs1)c1ccco1.
What is the InChIKey of N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide?
The InChIKey is MAPXRAPQHDKUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrN3O2S/c15-10-5-3-9(4-6-10)11-8-21-14(16-11)18-17-13(19)12-2-1-7-20-12/h1-8H,(H,16,18)(H,17,19).
What are the key properties of N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide?
N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide has a molecular weight of 364.22 g/mol, XLogP of 3.92, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]furan-2-carbohydrazide is sourced from PubChem (CID 1037907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).