About 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate
2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate (PubChem CID 10379071) has the molecular formula C10H9N3O7
and a molecular weight of 283.20 g/mol. Its IUPAC name is 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate.
Molecular Properties
| Compound Name | 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate |
| PubChem CID | 10379071 |
| Molecular Formula | C10H9N3O7 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2OCN1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N3O7/c14-10-8-5-7(12(15)16)1-2-9(8)19-6-11(10)3-4-20-13(17)18/h1-2,5H,3-4,6H2 |
| InChIKey | RTYCQOGKZWHQTO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate?
The IUPAC name of 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate (CID 10379071) is 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate.
What is the SMILES notation for 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate?
The canonical SMILES for 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate is O=C1c2cc([N+](=O)[O-])ccc2OCN1CCO[N+](=O)[O-].
What is the InChIKey of 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate?
The InChIKey is RTYCQOGKZWHQTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O7/c14-10-8-5-7(12(15)16)1-2-9(8)19-6-11(10)3-4-20-13(17)18/h1-2,5H,3-4,6H2.
What are the key properties of 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate?
2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate has a molecular weight of 283.20 g/mol, XLogP of 0.60, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-nitro-4-oxo-2H-1,3-benzoxazin-3-yl)ethyl nitrate is sourced from PubChem (CID 10379071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).