C13H15ClINO3 — CID 103790952
3-[(5-chloro-2-iodobenzoyl)-ethylamino]-2-methylpropanoic acid (PubChem CID 103790952) has the molecular formula C13H15ClINO3 and a molecular weight of 395.62 g/mol. Its IUPAC name is 3-[(5-chloro-2-iodobenzoyl)-ethylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(5-chloro-2-iodobenzoyl)-ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 103790952 |
| Molecular Formula | C13H15ClINO3 |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | 3-[(5-chloro-2-iodobenzoyl)-ethylamino]-2-methylpropanoic acid |
| SMILES | CCN(CC(C)C(=O)O)C(=O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C13H15ClINO3/c1-3-16(7-8(2)13(18)19)12(17)10-6-9(14)4-5-11(10)15/h4-6,8H,3,7H2,1-2H3,(H,18,19) |
| InChIKey | NSUFOGGMZHJNTC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|