C8H11Cl2NO3 — CID 103791157
(2R)-2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]propanoic acid (PubChem CID 103791157) has the molecular formula C8H11Cl2NO3 and a molecular weight of 240.09 g/mol. Its IUPAC name is (2R)-2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 103791157 |
| Molecular Formula | C8H11Cl2NO3 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | (2R)-2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)C1(C)CC1(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C8H11Cl2NO3/c1-4(5(12)13)11-6(14)7(2)3-8(7,9)10/h4H,3H2,1-2H3,(H,11,14)(H,12,13)/t4-,7?/m1/s1 |
| InChIKey | FBFWBORTNOZSHW-AWGJQOPUSA-N |
| XLogP | 1.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|