C15H14F3NO — CID 103792326
1-phenyl-2-[(2,4,5-trifluorophenyl)methylamino]ethanol (PubChem CID 103792326) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is 1-phenyl-2-[(2,4,5-trifluorophenyl)methylamino]ethanol.
| Compound Name | 1-phenyl-2-[(2,4,5-trifluorophenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 103792326 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-phenyl-2-[(2,4,5-trifluorophenyl)methylamino]ethanol |
| SMILES | OC(CNCc1cc(F)c(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C15H14F3NO/c16-12-7-14(18)13(17)6-11(12)8-19-9-15(20)10-4-2-1-3-5-10/h1-7,15,19-20H,8-9H2 |
| InChIKey | OMEVTNXAXVHZIM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|