C15H13BrF3N — CID 103792453
1-(3-bromophenyl)-N-[(2,4,5-trifluorophenyl)methyl]ethanamine (PubChem CID 103792453) has the molecular formula C15H13BrF3N and a molecular weight of 344.17 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[(2,4,5-trifluorophenyl)methyl]ethanamine.
| Compound Name | 1-(3-bromophenyl)-N-[(2,4,5-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103792453 |
| Molecular Formula | C15H13BrF3N |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 1-(3-bromophenyl)-N-[(2,4,5-trifluorophenyl)methyl]ethanamine |
| SMILES | CC(NCc1cc(F)c(F)cc1F)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H13BrF3N/c1-9(10-3-2-4-12(16)5-10)20-8-11-6-14(18)15(19)7-13(11)17/h2-7,9,20H,8H2,1H3 |
| InChIKey | YGOOLHKYACLZTN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|