About 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one
3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 10379306) has the molecular formula C18H13N3O
and a molecular weight of 287.32 g/mol. Its IUPAC name is 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 10379306 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1c(-c2ccccc2)cnc2c(-c3ccccc3)c[nH]n12 |
| InChI | InChI=1S/C18H13N3O/c22-18-16(14-9-5-2-6-10-14)11-19-17-15(12-20-21(17)18)13-7-3-1-4-8-13/h1-12,20H |
| InChIKey | MFCNIOYCTOSWRQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 10379306) is 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is O=c1c(-c2ccccc2)cnc2c(-c3ccccc3)c[nH]n12.
What is the InChIKey of 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is MFCNIOYCTOSWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O/c22-18-16(14-9-5-2-6-10-14)11-19-17-15(12-20-21(17)18)13-7-3-1-4-8-13/h1-12,20H.
What are the key properties of 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 287.32 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 10379306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).