C13H17F3N2O — CID 103794824
(2R)-2-amino-N-[2-methyl-5-(trifluoromethyl)phenyl]pentanamide (PubChem CID 103794824) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-methyl-5-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | (2R)-2-amino-N-[2-methyl-5-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 103794824 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (2R)-2-amino-N-[2-methyl-5-(trifluoromethyl)phenyl]pentanamide |
| SMILES | CCC[C@@H](N)C(=O)Nc1cc(C(F)(F)F)ccc1C |
| InChI | InChI=1S/C13H17F3N2O/c1-3-4-10(17)12(19)18-11-7-9(13(14,15)16)6-5-8(11)2/h5-7,10H,3-4,17H2,1-2H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | UZIFBVLJUZAJST-SNVBAGLBSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |