About 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile
3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile (PubChem CID 10379616) has the molecular formula C17H9F2N3
and a molecular weight of 293.28 g/mol. Its IUPAC name is 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile |
| PubChem CID | 10379616 |
| Molecular Formula | C17H9F2N3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cnnc(-c3ccc(F)c(F)c3)c2)c1 |
| InChI | InChI=1S/C17H9F2N3/c18-15-5-4-13(7-16(15)19)17-8-14(10-21-22-17)12-3-1-2-11(6-12)9-20/h1-8,10H |
| InChIKey | BKJDICAMUYQJHV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile?
The IUPAC name of 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile (CID 10379616) is 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile.
What is the SMILES notation for 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile?
The canonical SMILES for 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile is N#Cc1cccc(-c2cnnc(-c3ccc(F)c(F)c3)c2)c1.
What is the InChIKey of 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile?
The InChIKey is BKJDICAMUYQJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9F2N3/c18-15-5-4-13(7-16(15)19)17-8-14(10-21-22-17)12-3-1-2-11(6-12)9-20/h1-8,10H.
What are the key properties of 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile?
3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile has a molecular weight of 293.28 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(3,4-difluorophenyl)pyridazin-4-yl]benzonitrile is sourced from PubChem (CID 10379616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).