C19H24N2O — CID 10379833
8-[prop-2-enyl(propyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde (PubChem CID 10379833) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 8-[prop-2-enyl(propyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde.
| Compound Name | 8-[prop-2-enyl(propyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
|---|---|
| PubChem CID | 10379833 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 8-[prop-2-enyl(propyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
| SMILES | C=CCN(CCC)C1CCc2ccc3[nH]cc(C=O)c3c2C1 |
| InChI | InChI=1S/C19H24N2O/c1-3-9-21(10-4-2)16-7-5-14-6-8-18-19(17(14)11-16)15(13-22)12-20-18/h3,6,8,12-13,16,20H,1,4-5,7,9-11H2,2H3 |
| InChIKey | DBGOPRYLVZPMHQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|