C17H32O2Si — CID 10379840
(2E,4S,5R,6E)-5-[(2-methylpropan-2-yl)oxy]-6-(trimethylsilylmethylidene)nona-2,8-dien-4-ol (PubChem CID 10379840) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (2E,4S,5R,6E)-5-[(2-methylpropan-2-yl)oxy]-6-(trimethylsilylmethylidene)nona-2,8-dien-4-ol.
| Compound Name | (2E,4S,5R,6E)-5-[(2-methylpropan-2-yl)oxy]-6-(trimethylsilylmethylidene)nona-2,8-dien-4-ol |
|---|---|
| PubChem CID | 10379840 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (2E,4S,5R,6E)-5-[(2-methylpropan-2-yl)oxy]-6-(trimethylsilylmethylidene)nona-2,8-dien-4-ol |
| SMILES | C=CC/C(=C\[Si](C)(C)C)[C@@H](OC(C)(C)C)[C@@H](O)/C=C/C |
| InChI | InChI=1S/C17H32O2Si/c1-9-11-14(13-20(6,7)8)16(15(18)12-10-2)19-17(3,4)5/h9-10,12-13,15-16,18H,1,11H2,2-8H3/b12-10+,14-13+/t15-,16+/m0/s1 |
| InChIKey | VTNHYYHCEDEYLC-CAWZZXEKSA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|