About N-propylhexadecanamide
N-propylhexadecanamide (PubChem CID 10379895) has the molecular formula C19H39NO
and a molecular weight of 297.53 g/mol. Its IUPAC name is N-propylhexadecanamide.
Molecular Properties
| Compound Name | N-propylhexadecanamide |
| PubChem CID | 10379895 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | N-propylhexadecanamide |
| SMILES | CCCCCCCCCCCCCCCC(=O)NCCC |
| InChI | InChI=1S/C19H39NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)20-18-4-2/h3-18H2,1-2H3,(H,20,21) |
| InChIKey | HBMSIPLIFIVUKZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propylhexadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylhexadecanamide?
The IUPAC name of N-propylhexadecanamide (CID 10379895) is N-propylhexadecanamide.
What is the SMILES notation for N-propylhexadecanamide?
The canonical SMILES for N-propylhexadecanamide is CCCCCCCCCCCCCCCC(=O)NCCC.
What is the InChIKey of N-propylhexadecanamide?
The InChIKey is HBMSIPLIFIVUKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)20-18-4-2/h3-18H2,1-2H3,(H,20,21).
What are the key properties of N-propylhexadecanamide?
N-propylhexadecanamide has a molecular weight of 297.53 g/mol, XLogP of 5.99, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylhexadecanamide is sourced from PubChem (CID 10379895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).