C14H12F3NO3 — CID 10379977
(4S)-4-benzyl-3-[(E)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 10379977) has the molecular formula C14H12F3NO3 and a molecular weight of 299.25 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10379977 |
| Molecular Formula | C14H12F3NO3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (4S)-4-benzyl-3-[(E)-4,4,4-trifluorobut-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/C(F)(F)F)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H12F3NO3/c15-14(16,17)7-6-12(19)18-11(9-21-13(18)20)8-10-4-2-1-3-5-10/h1-7,11H,8-9H2/b7-6+/t11-/m0/s1 |
| InChIKey | YJZFRJWNPXLOQS-MLRMMBSGSA-N |
| XLogP | 2.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|