C11H11F3N2O4 — CID 103800115
2-hydroxy-N-methyl-3-nitro-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 103800115) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-hydroxy-N-methyl-3-nitro-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 2-hydroxy-N-methyl-3-nitro-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 103800115 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-hydroxy-N-methyl-3-nitro-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | CN(CCC(F)(F)F)C(=O)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C11H11F3N2O4/c1-15(6-5-11(12,13)14)10(18)7-3-2-4-8(9(7)17)16(19)20/h2-4,17H,5-6H2,1H3 |
| InChIKey | UPQGUIUALZEYHG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|