About N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide
N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide (PubChem CID 103801029) has the molecular formula C11H19NO2S
and a molecular weight of 229.34 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide.
Molecular Properties
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide |
| PubChem CID | 103801029 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCCSCCCO |
| InChI | InChI=1S/C11H19NO2S/c1-2-3-4-6-11(14)12-7-10-15-9-5-8-13/h2-4,6,13H,5,7-10H2,1H3,(H,12,14) |
| InChIKey | JPBBHNKXCFWSMA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide?
The IUPAC name of N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide (CID 103801029) is N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide.
What is the SMILES notation for N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide?
The canonical SMILES for N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide is CC=CC=CC(=O)NCCSCCCO.
What is the InChIKey of N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide?
The InChIKey is JPBBHNKXCFWSMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2S/c1-2-3-4-6-11(14)12-7-10-15-9-5-8-13/h2-4,6,13H,5,7-10H2,1H3,(H,12,14).
What are the key properties of N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide?
N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide has a molecular weight of 229.34 g/mol, XLogP of 1.35, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-hydroxypropylsulfanyl)ethyl]hexa-2,4-dienamide is sourced from PubChem (CID 103801029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).