About N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide
N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 103801065) has the molecular formula C9H16N4O2S
and a molecular weight of 244.32 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 103801065 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)NCCSCCCO |
| InChI | InChI=1S/C9H16N4O2S/c14-3-1-4-16-5-2-11-9(15)6-13-8-10-7-12-13/h7-8,14H,1-6H2,(H,11,15) |
| InChIKey | DUSVMZGUOWUTGL-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide (CID 103801065) is N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide is O=C(Cn1cncn1)NCCSCCCO.
What is the InChIKey of N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide?
The InChIKey is DUSVMZGUOWUTGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O2S/c14-3-1-4-16-5-2-11-9(15)6-13-8-10-7-12-13/h7-8,14H,1-6H2,(H,11,15).
What are the key properties of N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide?
N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide has a molecular weight of 244.32 g/mol, XLogP of -0.49, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 103801065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).