C16H22F3NO — CID 10380129
(3S)-1-propyl-3-[3-(2,2,2-trifluoroethoxy)phenyl]piperidine (PubChem CID 10380129) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is (3S)-1-propyl-3-[3-(2,2,2-trifluoroethoxy)phenyl]piperidine.
| Compound Name | (3S)-1-propyl-3-[3-(2,2,2-trifluoroethoxy)phenyl]piperidine |
|---|---|
| PubChem CID | 10380129 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (3S)-1-propyl-3-[3-(2,2,2-trifluoroethoxy)phenyl]piperidine |
| SMILES | CCCN1CCC[C@@H](c2cccc(OCC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H22F3NO/c1-2-8-20-9-4-6-14(11-20)13-5-3-7-15(10-13)21-12-16(17,18)19/h3,5,7,10,14H,2,4,6,8-9,11-12H2,1H3/t14-/m1/s1 |
| InChIKey | RMFLBNXQMNGIHR-CQSZACIVSA-N |
| XLogP | 4.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |