C14H21NO4S — CID 103801417
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2,6-dimethoxybenzamide (PubChem CID 103801417) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2,6-dimethoxybenzamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 103801417 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(C)C(CO)SC |
| InChI | InChI=1S/C14H21NO4S/c1-9(12(8-16)20-4)15-14(17)13-10(18-2)6-5-7-11(13)19-3/h5-7,9,12,16H,8H2,1-4H3,(H,15,17) |
| InChIKey | OJLOJSMSLSRPLF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |