C11H16N2O3S — CID 103801487
5-hydroxy-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)pyridine-3-carboxamide (PubChem CID 103801487) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 5-hydroxy-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)pyridine-3-carboxamide.
| Compound Name | 5-hydroxy-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103801487 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 5-hydroxy-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)pyridine-3-carboxamide |
| SMILES | CSC(CO)C(C)NC(=O)c1cncc(O)c1 |
| InChI | InChI=1S/C11H16N2O3S/c1-7(10(6-14)17-2)13-11(16)8-3-9(15)5-12-4-8/h3-5,7,10,14-15H,6H2,1-2H3,(H,13,16) |
| InChIKey | MLGYHXMFSRZVGE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |