C6H2F12 — CID 10380153
1,1,1,2,2,3,3,4,5,6,6,6-dodecafluorohexane (PubChem CID 10380153) has the molecular formula C6H2F12 and a molecular weight of 302.06 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,5,6,6,6-dodecafluorohexane.
| Compound Name | 1,1,1,2,2,3,3,4,5,6,6,6-dodecafluorohexane |
|---|---|
| PubChem CID | 10380153 |
| Molecular Formula | C6H2F12 |
| Molecular Weight | 302.06 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 1,1,1,2,2,3,3,4,5,6,6,6-dodecafluorohexane |
| SMILES | FC(C(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H2F12/c7-1(2(8)4(11,12)13)3(9,10)5(14,15)6(16,17)18/h1-2H |
| InChIKey | CFFHSACFFDWUFU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.06 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|