About ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate
ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate (PubChem CID 10380168) has the molecular formula C11H21F2O5P
and a molecular weight of 302.25 g/mol. Its IUPAC name is ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate.
Molecular Properties
| Compound Name | ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate |
| PubChem CID | 10380168 |
| Molecular Formula | C11H21F2O5P |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H21F2O5P/c1-5-16-10(14)9(4)8-11(12,13)19(15,17-6-2)18-7-3/h9H,5-8H2,1-4H3 |
| InChIKey | YAXGFSDTVRWKML-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate?
The IUPAC name of ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate (CID 10380168) is ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate.
What is the SMILES notation for ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate?
The canonical SMILES for ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate is CCOC(=O)C(C)CC(F)(F)P(=O)(OCC)OCC.
What is the InChIKey of ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate?
The InChIKey is YAXGFSDTVRWKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2O5P/c1-5-16-10(14)9(4)8-11(12,13)19(15,17-6-2)18-7-3/h9H,5-8H2,1-4H3.
What are the key properties of ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate?
ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate has a molecular weight of 302.25 g/mol, XLogP of 3.43, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-diethoxyphosphoryl-4,4-difluoro-2-methylbutanoate is sourced from PubChem (CID 10380168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).