C12H18F4N2O3 — CID 103801707
N-(3-hydroxypropyl)-1-(2,2,3,3-tetrafluoropropanoyl)piperidine-4-carboxamide (PubChem CID 103801707) has the molecular formula C12H18F4N2O3 and a molecular weight of 314.28 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1-(2,2,3,3-tetrafluoropropanoyl)piperidine-4-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-1-(2,2,3,3-tetrafluoropropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 103801707 |
| Molecular Formula | C12H18F4N2O3 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-(3-hydroxypropyl)-1-(2,2,3,3-tetrafluoropropanoyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCO)C1CCN(C(=O)C(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C12H18F4N2O3/c13-10(14)12(15,16)11(21)18-5-2-8(3-6-18)9(20)17-4-1-7-19/h8,10,19H,1-7H2,(H,17,20) |
| InChIKey | BYQXVHFVWANHEH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|