7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid

C15H11BrO2 — CID 10380223

IUPAC7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)CCc1cc(Br)ccc1-2
InChIInChI=1S/C15H11BrO2/c16-12-4-6-14-10(8-12)2-1-9-7-11(15(17)18)3-5-13(9)14/h3-8H,1-2H2,(H,17,18)
InChIKeyQXEZLMVQNMVYRX-UHFFFAOYSA-N
MW303.16 g/mol
LogP3.91
Rot. Bonds1

About 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid

7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid (PubChem CID 10380223) has the molecular formula C15H11BrO2 and a molecular weight of 303.16 g/mol. Its IUPAC name is 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid.

Molecular Properties

Compound Name7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid
PubChem CID10380223
Molecular FormulaC15H11BrO2
Molecular Weight303.16 g/mol
Exact Mass301.99
IUPAC Name7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)CCc1cc(Br)ccc1-2
InChIInChI=1S/C15H11BrO2/c16-12-4-6-14-10(8-12)2-1-9-7-11(15(17)18)3-5-13(9)14/h3-8H,1-2H2,(H,17,18)
InChIKeyQXEZLMVQNMVYRX-UHFFFAOYSA-N
XLogP3.91
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.16
LogP ≤ 53.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid?
The IUPAC name of 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid (CID 10380223) is 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid.
What is the SMILES notation for 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid?
The canonical SMILES for 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid is O=C(O)c1ccc2c(c1)CCc1cc(Br)ccc1-2.
What is the InChIKey of 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid?
The InChIKey is QXEZLMVQNMVYRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrO2/c16-12-4-6-14-10(8-12)2-1-9-7-11(15(17)18)3-5-13(9)14/h3-8H,1-2H2,(H,17,18).
What are the key properties of 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid?
7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid has a molecular weight of 303.16 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-9,10-dihydrophenanthrene-2-carboxylic acid is sourced from PubChem (CID 10380223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).