C15H20N4O3 — CID 10380312
5-amino-8,14,14-trimethyl-13,15-dioxa-1,8,10-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-9-one (PubChem CID 10380312) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 5-amino-8,14,14-trimethyl-13,15-dioxa-1,8,10-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-9-one.
| Compound Name | 5-amino-8,14,14-trimethyl-13,15-dioxa-1,8,10-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 10380312 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 5-amino-8,14,14-trimethyl-13,15-dioxa-1,8,10-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-9-one |
| SMILES | CN1C(=O)N2CC3OC(C)(C)OC3CN2c2ccc(N)cc21 |
| InChI | InChI=1S/C15H20N4O3/c1-15(2)21-12-7-18-10-5-4-9(16)6-11(10)17(3)14(20)19(18)8-13(12)22-15/h4-6,12-13H,7-8,16H2,1-3H3 |
| InChIKey | PNBNSYRKPMYMMT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|