C9H13F4NO3 — CID 103804076
4-methyl-4-(2,2,3,3-tetrafluoropropanoylamino)pentanoic acid (PubChem CID 103804076) has the molecular formula C9H13F4NO3 and a molecular weight of 259.20 g/mol. Its IUPAC name is 4-methyl-4-(2,2,3,3-tetrafluoropropanoylamino)pentanoic acid.
| Compound Name | 4-methyl-4-(2,2,3,3-tetrafluoropropanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 103804076 |
| Molecular Formula | C9H13F4NO3 |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-methyl-4-(2,2,3,3-tetrafluoropropanoylamino)pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H13F4NO3/c1-8(2,4-3-5(15)16)14-7(17)9(12,13)6(10)11/h6H,3-4H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | GBMROUCLMHIBIM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|