C11H11ClN2O5 — CID 103804465
(2R)-2-[(3-chloro-2-nitrobenzoyl)amino]butanoic acid (PubChem CID 103804465) has the molecular formula C11H11ClN2O5 and a molecular weight of 286.67 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-2-nitrobenzoyl)amino]butanoic acid.
| Compound Name | (2R)-2-[(3-chloro-2-nitrobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 103804465 |
| Molecular Formula | C11H11ClN2O5 |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | (2R)-2-[(3-chloro-2-nitrobenzoyl)amino]butanoic acid |
| SMILES | CC[C@@H](NC(=O)c1cccc(Cl)c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H11ClN2O5/c1-2-8(11(16)17)13-10(15)6-4-3-5-7(12)9(6)14(18)19/h3-5,8H,2H2,1H3,(H,13,15)(H,16,17)/t8-/m1/s1 |
| InChIKey | RLUARZANSKYJAK-MRVPVSSYSA-N |
| XLogP | 1.84 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|