C16H21FN2O3 — CID 10380559
N-(6-fluoro-7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-N-propylpropanamide (PubChem CID 10380559) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is N-(6-fluoro-7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-N-propylpropanamide.
| Compound Name | N-(6-fluoro-7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-N-propylpropanamide |
|---|---|
| PubChem CID | 10380559 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-(6-fluoro-7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-N-propylpropanamide |
| SMILES | CCCN(C(=O)CC)C1CCc2cc(F)c([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C16H21FN2O3/c1-3-7-18(16(20)4-2)13-6-5-11-9-14(17)15(19(21)22)10-12(11)8-13/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | OWLFKDZCDBDKTN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|