C16H22ClIN2O — CID 103805724
(3-chloro-4-iodophenyl)-[3-[(propan-2-ylamino)methyl]piperidin-1-yl]methanone (PubChem CID 103805724) has the molecular formula C16H22ClIN2O and a molecular weight of 420.72 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-[3-[(propan-2-ylamino)methyl]piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-iodophenyl)-[3-[(propan-2-ylamino)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 103805724 |
| Molecular Formula | C16H22ClIN2O |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | (3-chloro-4-iodophenyl)-[3-[(propan-2-ylamino)methyl]piperidin-1-yl]methanone |
| SMILES | CC(C)NCC1CCCN(C(=O)c2ccc(I)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H22ClIN2O/c1-11(2)19-9-12-4-3-7-20(10-12)16(21)13-5-6-15(18)14(17)8-13/h5-6,8,11-12,19H,3-4,7,9-10H2,1-2H3 |
| InChIKey | CJARJNUNAHAKQE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|